Synonym: δ-Gluconolactone; 1,2,3,4,5-Pentahydroxycaproic acid δ-lactone; D-(+)-Dextronic acid δ-lactone
CAS Number: 90-80-2
Empirical Formula (Hill Notation): C6H10O6
Molecular Weight: 178.14
EC Number: 202-016-5
MDL Number: MFCD00006647
Linear Formula: C6H10O6
Product Type: Chemical
| analyte chemical class(es) |
oligosaccharides |
| application(s) |
food and beverages |
| assay |
≥98.0% (GC) |
| biological source |
microbial |
| form |
powder or crystals |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C6H10O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-5,7-10H,1H2/t2-,3-,4+,5-/m1/s1 |
| InChI key |
PHOQVHQSTUBQQK-SQOUGZDYSA-N |
| mp |
160 °C (dec.) (lit.) |
| optical activity |
[α]/D 66.0±1.0, c = 4% (w/v) in water |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
OC[C@H]1OC(=O)[C@H](O)[C@@H](O)[C@@H]1O |
| Biochem/physiol Actions: |
Glucono-d-lactone increased the doubling time and activated enzymes involved in the oxidative pentose phosphate pathway of Saccharomyces cerevisiae. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (GC) |
| mp |
160 °C (dec.) (lit.) |
| UNSPSC |
12352200 |
