Synonym: 6-(Ethoxy-d5)-1,2-dihydro-2,2,4-trimethylquinoline; Ethoxyquin-d5
Empirical Formula (Hill Notation): C14D5H14NO
Molecular Weight: 222.34
MDL Number: MFCD29904983
Linear Formula: C14D5H14NO
Product Type: Chemical
| application(s) |
agriculture |
| assay |
≥98.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3/i1D3,5D2 |
| InChI key |
DECIPOUIJURFOJ-RPIBLTHZSA-N |
| product line |
PESTANAL® |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CC1=CC(C)(C)NC2=CC=C(OC([2H])([2H])C([2H])([2H])[2H])C=C21 |
| storage temp. |
2-8°C |
| Application: |
Isotope-labeled compounds are increasingly used in isotope dilution mass spectrometry (IDMS) for the quantitative analysis of pesticides. The major advantage of using this technique is that the isotope-labeled compounds have nearly the same physical properties as their non-labeled counterpart analogs, and thus show identical behavior during the workup and sample preparation process. This helps in overcoming the problems of matrix effects generally encountered in the usual LC-MS/GC-MS analysis, potentially resulting in biased results. By spiking the sample before workup with its isotope labeled analog, the loss of analyte that leads to matrix effects can be determined and compensated. |
| General description: |
Ethoxyquin-(ethoxy-d5) is an isotope labeled analog of ethoxyquin − an antioxidant used as a protectant/post-harvest fungicide in animal feed as well as agricultural products, wherein the ethoxy protons are replaced by deuterium. |
| Legal Information: |
PESTANAL is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Symbol |
 GHS07 |
| Signal word |
Warning |
| Hazard statements |
H302 |
| Precautionary statements |
P301 + P312 + P330 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
41116107 |
