Phosphomolybdic acid hydrate
SIAL/79560 - suitable for microscopy
Synonym: Molybdophosphoric acid
CAS Number: 51429-74-4
Empirical Formula (Hill Notation): H3Mo12O40P · xH2O
Molecular Weight: 1825.25 (anhydrous basis)
EC Number: 234-713-5
MDL Number: MFCD00149913
Linear Formula: H3[P(Mo3O10)4] · xH2O
Product Type: Chemical
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤100 mg/kg | |
| cation traces | Ca: ≤50 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤20 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤10 mg/kg | |
| Fe: ≤50 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤20 mg/kg | |
| Mn: ≤100 mg/kg | |
| Na: ≤50 mg/kg | |
| NH4+: ≤30 mg/kg | |
| Ni: ≤10 mg/kg | |
| Pb: ≤20 mg/kg | |
| Zn: ≤50 mg/kg | |
| density | 1.62 g/mL at 25 °C (lit.) |
| form | crystals |
| InChI | 1S/12Mo.H3O4P.H2O.36O/c;; |
| InChI key | PDDXOPNEMCREGN-UHFFFAOYSA |
| loss | 21-23% loss on drying, 110 °C |
| Quality Level | 100 ![]() |
| reaction suitability | reagent type: oxidant |
| SMILES string | O.O=[Mo](=O)=O.O=[Mo](=O) |
| suitability | suitable for microscopy |
| technique(s) | thin layer chromatography (TLC): suitable |
| Application: | A precursor to hybrid organic-inorganic based molecular batteries with applications as cation-insertion electrodes. |
| Application: | PAH was used in preparing Mo-Al2O3 catalysts in an attempt to produce ultra-low sulphur diesel. |
| General description: | Phosphomolybdic acid hydrate (PAH) is yellow and crystallisable compound. It precipitates from potash, oxides of rubidium, caesium and thallium, ammonia and other nitrogenous organic alkaloids. |
| Other Notes: | Review: of the folin phenol method for the quantitative determination of proteins. |
| Symbol | ![]() GHS03,GHS05 |
| Signal word | Danger |
| Hazard statements | H272 - H314 |
| Precautionary statements | P210 - P220 - P260 - P280 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | O,C |
| Risk Statements | 8-34 |
| Safety Statements | 17-26-36/37/39-45 |
| RIDADR | UN 3084 5.1(8) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.62 g/mL at 25 °C (lit.) |
| UNSPSC | 41115710 |



