Phthalic acid
SIAL/80010 - puriss. p.a., ≥99.5% (T)
Synonym: 1,2-
CAS Number: 88-99-3
Empirical Formula (Hill Notation): C8H6O4
Molecular Weight: 166.13
EC Number: 201-873-2
MDL Number: MFCD00002467
Linear Formula: C6H4-1,2-(CO2H)2
Product Type: Chemical
| anion traces | chloride (Cl-): ≤10 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.5% (T) |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | powder or crystals |
| functional group | carboxylic acid |
| grade | puriss. p.a. |
| ign. residue | ≤0.02% (as SO4) |
| InChI | 1S/C8H6O4/c9-7(10)5-3-1-2 |
| InChI key | XNGIFLGASWRNHJ-UHFFFAOYSA |
| mp | 210-211 °C (dec.) (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | OC(C1=C(C(O)=O)C=CC=C1)=O |
| solubility | water: soluble(lit.) |
| Application: | Phthalic acid may be used in the synthesis of benzoic acid. It may be used to constitute the mobile phase during hydrophilic interaction liquid chromatography (HILIC) coupled with electrospray ionization tandem mass spectrometric (ESI-MS/MS) analysis of free amino acids (AAs) in human thyroid tissues. |
| General description: | Phthalic acid (1,2-benzenedicarboxylic acid) is an aromatic dicarboxylic acid. On heating, it undergoes dehydration to afford cyclic anhydride. It can be synthesized from phthalic anhydride. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P261 - P264 - P271 - P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Purity | ≥99.5% (T) |
| mp | 210-211 °C (dec.) (lit.) |
| UNSPSC | 12352100 |


