(−)-α-Pinene
SIAL/80599 - analytical standard
Synonym: (1S,5S)
CAS Number: 7785-26-4
Empirical Formula (Hill Notation): C10H16
Molecular Weight: 136.23
EC Number: 232-077-3
MDL Number: MFCD00064145
Linear Formula: C10H16
Product Type: Chemical
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥99.0% (sum of enantiomers, GC) |
| bp | 156-158 °C (lit.) |
| density | 0.858 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9( |
| InChI key | GRWFGVWFFZKLTI-IUCAKERBSA |
| optical activity | [α]20/D −50±2°, neat |
| Quality Level | 100  |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC1=CC[C@H]2C[C@@H]1C2(C) |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | (−)-α-Pinene is a volatile mono-terpenoid compound, that is found in the resins of pine trees and other conifers. It contains an endocyclic double bond in its structure. |
| Other Notes: | This compound is commonly found in plants of the genus: angelica cannabis cinnamomum echinacea echinacea eucalyptus salvia thymus valeriana |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226 - H302 - H304 - H315 - H317 - H410 |
| Precautionary statements | P210 - P273 - P280 - P301 + P310 + P331 - P301 + P312 + P330 - P302 + P352 |
| Hazard Codes | Xi,N |
| Risk Statements | 10-36/37/38-43-50 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 2368 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 88.3 °F |
| Flash Point(C) | 31.3 °C |
| Purity | ≥99.0% (sum of enantiomers, GC) |
| bp | 156-158 °C (lit.) |
| Density | 0.858 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |