(−)-β-Pinene
SIAL/80609 - analytical standard
Synonym: (1S,5S)-2(10)-Pinene; (1S,5S)
CAS Number: 18172-67-3
Empirical Formula (Hill Notation): C10H16
Molecular Weight: 136.23
EC Number: 242-060-2
MDL Number: MFCD00001345
Linear Formula: C10H16
Product Type: Chemical
| application(s) | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| assay | ≥98.5% (sum of enantiomers, GC) |
| bp | 164-165 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9( |
| InChI key | WTARULDDTDQWMU-IUCAKERBSA |
| optical activity | [α]20/D −22±1°, neat |
| Quality Level | 100  |
| refractive index | n |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC1(C)[C@H]2CCC(=C)[C@@H] |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | (-)-β-Pinene is a monoterpenoid, naturally found in the resins of pine trees and other conifers.It comprises of an exocyclic double bond in its structure. |
| Symbol |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226 - H304 - H315 - H317 - H410 |
| Precautionary statements | P210 - P273 - P280 - P301 + P310 - P303 + P361 + P353 - P331 |
| Hazard Codes | Xn,N |
| Risk Statements | 10-20/21/22-36/37/38-43-51-65 |
| Safety Statements | 16-26-36/37-46-61-62 |
| RIDADR | UN 2319 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 102.2 °F |
| Flash Point(C) | 39 °C |
| Purity | ≥98.5% (sum of enantiomers, GC) |
| bp | 164-165 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |