Synonym: 5,6-Diphenyl-3-(2-pyridyl)-1,2,4-triazine-4′,4″-disulfonic acid sodium salt; PDT disulfonate
CAS Number: 69898-45-9
Empirical Formula (Hill Notation): C20H13N4NaO6S2
Molecular Weight: 492.46
EC Number: 274-196-3
MDL Number: MFCD00078417
Linear Formula: C20H13N4NaO6S2
Product Type: Chemical
| assay |
97.0% |
| cation traces |
Co: ≤50 mg/kg |
| |
Cu: ≤50 mg/kg |
| |
Fe: ≤50 mg/kg |
| |
Mo: ≤50 mg/kg |
| |
Ni: ≤50 mg/kg |
| |
V: ≤50 mg/kg |
| |
Zn: ≤50 mg/kg |
| form |
solid |
| impurities |
~7% water |
| InChI |
1S/C20H14N4O6S2.Na/c25-31(26,27)15-8-4-13(5-9-15)18-19(14-6-10-16(11-7-14)32(28,29)30)23-24-20(22-18)17-3-1-2-12-21-17;/h1-12H,(H,25,26,27)(H,28,29,30);/q;+1/p-1 |
| InChI key |
ZGVNYCXXBQPDPQ-UHFFFAOYSA-M |
| mp |
≥300 °C |
| quality |
for spectrophotometric det. of Fe |
| Quality Level |
100  |
| SMILES string |
[Na+].OS(=O)(=O)c1ccc(cc1)-c2nnc(nc2-c3ccc(cc3)S([O-])(=O)=O)-c4ccccn4 |
| technique(s) |
UV/Vis spectroscopy: suitable |
| Application: |
It was used in determining of chelating activity of Fe2+ using Boyer and McCleary method. |
| General description: |
3-(2-Pyridyl)-5,6-diphenyl-1,2,4-triazine-4′,4′′-disulfonic acid sodium salt also known as Ferrozine is a chelating agent for ferrous iron. |
| Other Notes: |
Highly specific water-soluble reagent for the accurate determination of submicrogram levels of serum iron (pH 3.5-4.5, lmax 562 nm, A 29′000) |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
97.0% |
| mp |
≥300 °C |
| UNSPSC |
12352200 |
