(+)-α-Terpineol
SIAL/83073 - analytical standard
Synonym: (R)
CAS Number: 7785-53-7
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 232-081-5
MDL Number: MFCD00171435
Linear Formula: C10H18O
Product Type: Chemical
| application(s) | food and beverages |
| assay | ≥97.0% (sum of enantiomers, GC) |
| density | 0.94 g/mL at 20 °C (lit.) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C10H18O/c1-8-4-6-9(7-5 |
| InChI key | WUOACPNHFRMFPN-VIFPVBQESA |
| optical activity | [α]/D +90±10°, c = 0.1 in ethanol |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CC1=CC[C@@H](CC1)C(C)(C)O |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Packaging: | 5 mL in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | 194.0 °F - closed cup |
| Flash Point(C) | 90 °C - closed cup |
| Purity | ≥97.0% (sum of enantiomers, GC) |
| Density | 0.94 g/mL at 20 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |