Synonym: (3β, 16β, 17α, 18β, 20α)-11,17-Dimethoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]yohimban-16-carboxylic acid methyl ester
CAS Number: 50-55-5
Empirical Formula (Hill Notation): C33H40N2O9
Molecular Weight: 608.68
EC Number: 200-047-9
MDL Number: MFCD00005091
Linear Formula: C33H40N2O9
Product Type: Chemical
| assay |
≥99.0% (HPLC) |
| form |
solid |
| InChI |
1S/C33H40N2O9/c1-38-19-7-8-20-21-9-10-35-16-18-13-27(44-32(36)17-11-25(39-2)30(41-4)26(12-17)40-3)31(42-5)28(33(37)43-6)22(18)15-24(35)29(21)34-23(20)14-19/h7-8,11-12,14,18,22,24,27-28,31,34H,9-10,13,15-16H2,1-6H3/t18-,22+,24-,27-,28+,31+/m1/s1 |
| InChI key |
QEVHRUUCFGRFIF-MDEJGZGSSA-N |
| mp |
~265 °C (dec.) |
| optical activity |
[α]20/D −123±3°, c = 1% in chloroform |
| quality |
crystallized |
| SMILES string |
CO[C@H]1[C@@H](C[C@@H]2CN3CCc4c([nH]c5cc(OC)ccc45)[C@H]3C[C@@H]2[C@@H]1C(=O)OC)OC(=O)c6cc(OC)c(OC)c(OC)c6 |
| Application: |
Reserpine has been used as a test chemical in performance studies. |
| Biochem/physiol Actions: |
Inhibits vesicular uptake of catecholamines and serotonin. |
| Biochem/physiol Actions: |
Reserpine is used to treat hypertensive pregnancy difficulties. This drug is also considered as antipsychotic and antihypertensive, to regulate high blood pressure. |
| General description: |
Reserpine is an indole alkaloid that irreversibly binds vesicular monoamine transporters VMAT1 and VMAT2. It is a sympatholytic drug useful in treating systemic hypertension. |
| Packaging: |
1, 5 g in glass bottle |
| Purity |
≥99.0% (HPLC) |
| mp |
~265 °C (dec.) |
| UNSPSC |
12352200 |
GHS07,GHS08