Tamoxifen
SIAL/85256 - analytical standard
Synonym: (Z)
CAS Number: 10540-29-1
Empirical Formula (Hill Notation): C26H29NO
Molecular Weight: 371.51
EC Number: 234-118-0
MDL Number: MFCD00010454
Linear Formula: C6H5C(C2H5)=C(C6H5)C6H4OCH2CH2N(CH3)2
Product Type: Chemical
| application(s) | forensics and toxicology pharmaceutical (small molecule) |
| assay | ≥98.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| impurities | ≤0.5% water |
| InChI | 1S/C26H29NO/c1-4-25(21-11 |
| InChI key | NKANXQFJJICGDU-QPLCGJKRSA |
| mp | 97-98 °C (lit.) |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCC(c1ccccc1)=C(/c2ccccc |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: | Estrogen antagonist in mammary gland. Blocks estradiol-stimulated VEGF production in breast tumor cells. Protein kinase C inhibitor. |
| Biochem/physiol Actions: | Protein kinase C inhibitor. Induces apoptosis in human malignant glioma cell lines. Tamoxifen and its metabolite 4-hydroxytamoxifen are selective estrogen response modifiers (SERMs) that act as estrogen antagonists in mammary gland. Blocks estradiol-stimulated VEGF production in breast tumor cells. |
| Symbol | ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H350 - H360 - H410 |
| Precautionary statements | P201 - P273 - P308 + P313 |
| Hazard Codes | T |
| Risk Statements | 45-60-61-64 |
| Safety Statements | 53-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (HPLC) |
| mp | 97-98 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 41116107 |



