Methyl 4-hydroxybenzoate sodium salt
SIAL/85265 - tested according to Ph. Eur.
Synonym: Methylis parahydroxybenzoas natricum; Sodium methyl 4-hydroxybenzoate
CAS Number: 5026-62-0
Empirical Formula (Hill Notation): C8H7NaO3
Molecular Weight: 174.13
EC Number: 225-714-1
MDL Number: MFCD00016470
Linear Formula: C8H7NaO3
Product Type: Chemical
| agency | tested according to Ph. Eur. |
| USP/NF | |
| application(s) | pharmaceutical (small molecule) |
| form | powder |
| InChI | 1S/C8H8O3.Na/c1-11-8(10)6 |
| InChI key | PESXGULMKCKJCC-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | [Na+].COC(=O)c1ccc([O-])c |
| Application: |
|
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H315 - H318 - H412 |
| Precautionary statements | P273 - P280 - P302 + P352 - P305 + P351 + P338 + P310 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| UNSPSC | 12352300 |


