Silylating mixture III
SIAL/85433 - derivatization grade (GC derivatization), LiChropur™
Synonym: N,O-
Product Type: Chemical
| density | 0.944 g/mL at 20 °C |
| form | liquid |
| grade | derivatization grade (GC derivatization) |
| InChI key | QYDKGXJRRBFPPM-BZSKPOBNSA |
| quality | LiChropur™ |
| Quality Level | 100 ![]() |
| reaction suitability | reagent type: derivatization reagent reaction type: Silylations |
| SMILES string | C[Si](C)(C)Cl.C[Si](C)(C) |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| General description: | Silylating mixture III is one of the most potent general silylating agents used for gas chromatography derivatization, comprising of N,O-bis(trimethylsilyl)trifl |
| Legal Information: | LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | Powerful and general silylating mixture |
| Symbol | ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H225 - H302 + H332 - H314 - H335 |
| Precautionary statements | P210 - P280 - P301 + P312 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | F,C |
| Risk Statements | 11-14-35-37 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2924 8(3) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 37.4 °F |
| Flash Point(C) | 3 °C |
| Supplemental Hazard Statements | EUH014 |
| Density | 0.944 g/mL at 20 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |




