Spermine dihydrate
SIAL/85588 - BioUltra, ≥99.5% (GC)
Synonym: Gerontine; Musculamine; N,N′-Bis(3-aminopropyl)-1,4-diaminobutane; Neuridine
CAS Number: 403982-64-9
Empirical Formula (Hill Notation): C10H26N4 · 2H2O
Molecular Weight: 238.37
EC Number: 200-754-2
MDL Number: MFCD01459904
Linear Formula: NH2(CH2)3NH(CH2)4NH(CH2)3NH2 · 2H2O
Product Type: Chemical
| λ | 1 M in H2O |
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.5% (GC) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | powder |
| impurities | insoluble matter, passes filter test |
| InChI | 1S/C10H26N4.2H2O/c11-5-3- |
| InChI key | MTNRSMVAYLLBAV-UHFFFAOYSA |
| mp | 63-64 °C |
| pH | 12.0-13.5 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 100  |
| SMILES string | O.O.NCCCNCCCCNCCCN |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| storage temp. | 2-8°C |
| UV absorption | λ: 260 nm Amax: 0.20 |
| λ: 280 nm Amax: 0.20 |
| Biochem/physiol Actions: | Mixed NMDA agonist/antagonist at the polyamine site. Neuroprotective effects have been observed at high concentrations (1 mM), while neurotoxicity is observed at lower concentrations. It enhances agonist effectiveness at the strychnine-insensitive glycine site. Plays a role in cellular proliferation and differentiation; inhibits neuronal nitric oxide synthase (nNOS). |
| Biochem/physiol Actions: | Mixed NMDA agonist/antagonist at the polyamine site. Plays a role in cellular proliferation and differentiation; inhibits neuronal nitric oxide synthase (nNOS). |
| Other Notes: | Polyamines: Review; Inhibitor of ATPase; DNA polymerase; ribonuclease |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259PSN1 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% (GC) |
| mp | 63-64 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |