5-Sulfosalicylic acid dihydrate
SIAL/86195 - purum p.a., ≥98.0% (T)
Synonym: 2-
CAS Number: 5965-83-3
Empirical Formula (Hill Notation): C7H6O6S · 2H2O
Molecular Weight: 254.21
EC Number: 202-555-6
MDL Number: MFCD00149540
Linear Formula: HO3SC6H3-2-(OH)CO2H·2H2O
Product Type: Chemical
anion traces | chloride (Cl-): ≤50 mg/kg |
assay | ≥98.0% (T) |
cation traces | Ca: ≤50 mg/kg |
Cd: ≤50 mg/kg | |
Co: ≤50 mg/kg | |
Cu: ≤50 mg/kg | |
Fe: ≤50 mg/kg | |
K: ≤100 mg/kg | |
Na: ≤100 mg/kg | |
Ni: ≤50 mg/kg | |
Pb: ≤50 mg/kg | |
Zn: ≤50 mg/kg | |
form | solid |
grade | purum p.a. |
InChI | 1S/C7H6O6S.2H2O/c8-6-2-1- |
InChI key | BHDKTFQBRFWJKR-UHFFFAOYSA |
mp | 105-110 °C (lit.) |
Quality Level | 200 ![]() |
SMILES string | [H]O[H].[H]O[H].OC(=O)c1c |
solubility | water: soluble 127.1 g/L at 20 °C |
Application: | 5-Sulfosalicylic acid dihydrate may be used in the preparation of 1:1 proton-transfer organic adduct, 3-aminopyridinium 3-carboxy-4-hydroxybenz |
General description: | 5-Sulfosalicylic acid is strongly acidic in nature. It exists in various hydrated forms such as dihydrate, dideuterate, trihydrate and pentahydrate. It acts as a ligand and forms various coordination complexes. It forms a complex with theophylline. Crystal structure of the complex was investigated by X-ray photoelectron spectroscopy (XPS). |
Packaging: | 1 kg in poly bottle |
Packaging: | 50, 250 g in poly bottle |
Symbol | ![]() |
Signal word | Danger |
Hazard statements | H314 |
Precautionary statements | P260 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
Hazard Codes | Xn |
Risk Statements | 22-36/37/38 |
Safety Statements | 26-36/37/39-45 |
RIDADR | UN 3261 8 / PGII |
WGK Germany | WGK 1 |
Flash Point(F) | Not applicable |
Flash Point(C) | Not applicable |
Purity | ≥98.0% (T) |
mp | 105-110 °C (lit.) |
UNSPSC | 12352100 |