Tetraethylammonium hydrogen sulfate
SIAL/86626 - suitable for ion pair chromatography, LiChropur™, ≥99.0%
CAS Number: 16873-13-5
Empirical Formula (Hill Notation): C8H21NO4S
Molecular Weight: 227.32
EC Number: 240-899-9
MDL Number: MFCD00036150
Linear Formula: (C2H5)4N(HSO4)
Product Type: Chemical
| λ | 10 % in H2O |
| assay | ≥99.0% |
| ≥99.0% (T) | |
| description | cationic |
| form | crystals |
| InChI | 1S/C8H20N.H2O4S/c1-5-9(6- |
| InChI key | CREVBWLEPKAZBH-UHFFFAOYSA |
| mp | 243-245 °C |
| quality | LiChropur™ |
| Quality Level | 100  |
| SMILES string | OS([O-])(=O)=O.CC[N+](CC) |
| suitability | corresponds to standard for filter test |
| corresponds to standard for RP gradient test | |
| technique(s) | ion pair chromatography: suitable |
| UV absorption | λ: 210 nm Amax: 0.05 |
| λ: 220 nm Amax: 0.04 | |
| λ: 230 nm Amax: 0.03 | |
| λ: 260 nm Amax: 0.02 | |
| λ: 500 nm Amax: 0.02 |
| Application: | Tetraethylammonium hydrogen sulfate may be used as an ion pair reagent for the analysis of sulfonated aliphatic and aromatic surfactants in sewage sludge by ion-pair/supercritical fluid extraction and derivatization gas chromatography/mass spectrometry. |
| General description: | Tetraethylammonium hydrogen sulfate is an ion-pair chromatography (IPC) reagent suitable for anionic separation sorted by carbon chain length. |
| Legal Information: | LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | Discover LiChropur™ reagents ideal for HPLC or LC-MS analysis |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T); ≥99.0% |
| mp | 243-245 °C |
| UNSPSC | 23151816 |