Tetradodecylammonium nitrate
SIAL/87252 - Selectophore™, ≥99.0%
CAS Number: 63893-35-6
Empirical Formula (Hill Notation): C48H100N2O3
Molecular Weight: 753.32
EC Number: 264-548-4
MDL Number: MFCD00467971
Linear Formula: [CH3(CH2)10CH2]4N(NO3)
Product Type: Chemical
| assay | ≥99.0% |
| ≥99.0% (NT) | |
| description | for ion-selective electrodes |
| form | flakes |
| InChI | 1S/C48H100N.NO3/c1-5-9-13 |
| InChI key | AHQMUYHFUYRUJV-UHFFFAOYSA |
| mp | 103-105 °C |
| product line | Selectophore™ |
| Quality Level | 200 ![]() |
| SMILES string | [O-][N+]([O-])=O.CCCCCCCC |
| Application: | Selected application examples |
| Application: | Ion-pair suitable for a nitrate-selective field-effect transistor membrane. |
| Application: | TDDAN has been used as solvent in the preparation of microelectrodes based on AgI-Ag2O-V2O5 glass transducer. |
| General description: | Tetradodecylammonium nitrate (TDDAN) is a quaternary ammonium salt, mainly used as electrolyte. |
| General description: | Visit our Sensor Applications portal to learn more. |
| Legal Information: | Selectophore is a trademark of Merck KGaA, Darmstadt, Germany |
| Other Notes: | Ion-pair suitable for a nitrate-selective field-effect transistor membrane |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol | ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228 - H315 - H319 - H335 |
| Precautionary statements | P210 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN1325 - class 4.1 - PG 3 - Flammable solids, organic, n.o.s., H |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (NT); ≥99.0% |
| mp | 103-105 °C |
| UNSPSC | 26111700 |



