Erythrosin B
SIAL/87613 - analytical standard
Synonym: Erythrosin extra bluish; 2′,4′,5′,7′-Tetraiodofluorescein disodium salt; Acid Red 51; Iodoeosin
CAS Number: 16423-68-0
Empirical Formula (Hill Notation): C20H6I4Na2O5
Molecular Weight: 879.86
EC Number: 240-474-8
MDL Number: MFCD00144257
Linear Formula: C20H6I4Na2O5
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 87613-25MG
| application(s) | cleaning products cosmetics food and beverages personal care |
| assay | ≥98.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C20H8I4O5.2Na/c21-11-5 |
| InChI key | RAGZEDHHTPQLAI-UHFFFAOYSA |
| Quality Level | 100  |
| SMILES string | [Na+].[Na+].[O-]c1c(I)cc2 |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Erythrosin B belongs to the class of xanthene dyes, which can find applications as a food colorant.(12} It can exhibit light absorption in the range of 500-550 nm, hence can lead to the formation of reactive oxygen species, which can inactivate the microorganisms, thereby acting like an antimicrobial agent. |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H413 |
| Precautionary statements | P273 - P301 + P312 + P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 359.6 °F - closed cup |
| Flash Point(C) | 182 °C - closed cup |
| Purity | ≥98.0% (HPLC) |
| Colour Index Number | 45430 |
| UNSPSC | 85151701 |