2-Thenoyltrifluoroacetone
SIAL/88300 - for spectrophotometric det. of metal ions, ≥99.0%
Synonym: 4,4,4-
CAS Number: 326-91-0
Empirical Formula (Hill Notation): C8H5F3O2S
Molecular Weight: 222.18
EC Number: 206-316-7
MDL Number: MFCD00005445
Linear Formula: C8H5F3O2S
Product Type: Chemical
| assay | ≥99.0% |
| ≥99.0% (GC) | |
| bp | 96-98 °C/8 mmHg (lit.) |
| form | crystals |
| InChI | 1S/C8H5F3O2S/c9-8(10,11)7 |
| InChI key | TXBBUSUXYMIVOS-UHFFFAOYSA |
| mp | 40-44 °C (lit.) |
| 42-46 °C | |
| quality | for spectrophotometric det. of metal ions |
| Quality Level | 100  |
| reaction suitability | reagent type: derivatization reagent reaction type: Acylations |
| SMILES string | FC(F)(F)C(=O)CC(=O)c1cccs |
| storage temp. | 2-8°C |
| technique(s) | UV/Vis spectroscopy: suitable |
| Application: | 2-Thenoyltrifluoroacetone may be used as a chelating agent for the speciation of chromium in water and rice samples using surfactant-assisted emulsification dispersive liquid-liquid microextraction with electrothermal atomic absorption spectrometry technique. |
| Other Notes: | Reagent for the extraction and spectrophotometric determination of metals |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 233.6 °F - closed cup |
| Flash Point(C) | 112 °C - closed cup |
| Purity | ≥99.0% (GC); ≥99.0% |
| bp | 96-98 °C/8 mmHg (lit.) |
| mp | 40-44 °C (lit.); 42-46 °C |
| Storage Temp. | 2-8°C |
| UNSPSC | 12000000 |