Synonym: 4β,5β,6β,22R)-5,6-Epoxy-4,22,27-trihydroxy-1-oxo-ergosta-2,24-dien-26-oic acid δ-lactone; Withaferine
CAS Number: 5119-48-2
Empirical Formula (Hill Notation): C28H38O6
Molecular Weight: 470.60
MDL Number: MFCD10687098
Linear Formula: C28H38O6
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥95.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C28H38O6/c1-14-11-21(33-25(32)17(14)13-29)15(2)18-5-6-19-16-12-24-28(34-24)23(31)8-7-22(30)27(28,4)20(16)9-10-26(18,19)3/h7-8,15-16,18-21,23-24,29,31H,5-6,9-13H2,1-4H3/t15-,16-,18+,19-,20-,21+,23-,24+,26+,27-,28+/m0/s1 |
| InChI key |
DBRXOUCRJQVYJQ-CKNDUULBSA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
C[C@H]([C@H]1CC(C)=C(CO)C(=O)O1)[C@H]2CC[C@H]3[C@@H]4C[C@H]5O[C@]56[C@@H](O)C=CC(=O)[C@]6(C)[C@H]4CC[C@]23C |
| storage temp. |
2-8°C |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Other Notes: |
This compound is commonly found in plants of the genus: withania |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
438.8 °F |
| Flash Point(C) |
226 °C |
| Purity |
≥95.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
85151701 |
