D-(+)-Trehalose dihydrate
SIAL/90210 - suitable for microbiology, ≥99.0%, composed of two α-glucose units that is used as a protectant, stabilizer and to support proper folding
Synonym: Trehalose dihydrate, a-
CAS Number: 6138-23-4
Empirical Formula (Hill Notation): C12H22O11 · 2H2O
Molecular Weight: 378.33
EC Number: 202-739-6
MDL Number: MFCD00071594
Linear Formula: C12H22O11 · 2H2O
Product Type: Chemical
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| application(s) | microbiology |
| assay | ≥99.0% |
| ≥99.0% (HPLC) | |
| cation traces | As: ≤0.1 mg/kg |
| Ca: ≤200 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤10 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤10 mg/kg | |
| form | powder |
| ign. residue | ≤0.1% (as SO4) |
| impurities | ≤0.1% glucose |
| InChI | 1S/C12H22O11.2H2O/c13-1-3 |
| InChI key | DPVHGFAJLZWDOC-PVXXTIHASA |
| mol wt | 378.33 g/mol |
| optical activity | [α]20/D +176 to +186°, c = 2% in H2O |
| Quality Level | 200  |
| SMILES string | [H]O[H].[H]O[H].OC[C@H]1O |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| Application: | D-(+)-Trehalose can be used as a carbohydrate reserve in certain cell cultures to tide over environmental stresses. It can also be used in biopharmaceutical monoclonal antibody formulations and as a protein stabilizer. |
| General description: | D-(+)-Trehalose is a disaccharide composed of two α-glucose units. It is used as a cryoprotectant in a variety of cell freezing media. Used as a protectant in transportation media. It predominantly exists among the species that support anhydrobiosis (life without water). It serves as a carbohydrate reserve in microorganisms and protects them from adverse conditions, such as heat, cold, dehydration, desiccation, and oxidation. Trehalose acts as a chemical chaperone affecting protein folding. It is known to prevent the generation of amyloids and accumulation of β-amyloid in vitro. A similar effect of trehalose has been observed with Huntingtin protein aggregation. Thus, it might serve as a protective agent in Alzheimer′s disease and Huntington′s disease. Trehalose stimulates the better initial growth of Salmonella cells. |
| Packaging: | 10, 50, 250 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (HPLC); ≥99.0% |
| UNSPSC | 41106212 |