Synonym: (S)-5-(1-Hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexen-1-yl)-3-methyl-(2Z,4E)-pentadienoic acid; ABA; Dormin
CAS Number: 21293-29-8
Empirical Formula (Hill Notation): C15H20O4
Molecular Weight: 264.32
EC Number: 244-319-5
MDL Number: MFCD00066545
Linear Formula: C15H20O4
Product Type: Chemical
| assay |
≥98.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7-/t15-/m1/s1 |
| InChI key |
JLIDBLDQVAYHNE-YKALOCIXSA-N |
| optical activity |
[α]/D 415±10°, c = 0.1 in ethanol |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
CC(C=C[C@@]1(O)C(C)=CC(=O)CC1(C)C)=CC(O)=O |
| storage temp. |
2-8°C |
| Biochem/physiol Actions: |
Plant hormone and growth regulator that is involved in several physiological mechanisms including seed dormancy, leaf abscission, stomatal movement, and plant stress responses. Through complex interactions with several intracellular signaling systems, it can regulate the expression of hundreds of plant genes. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352106 |