Synonym: 4′,5,6,7,8-Pentamethoxyflavone; 5,6,7,8-Tetramethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one; NSC 53909; NSC 618905; Ponkanetin
CAS Number: 481-53-8
Empirical Formula (Hill Notation): C20H20O7
Molecular Weight: 372.37
EC Number: 207-570-1
MDL Number: MFCD00017438
Linear Formula: C20H20O7
Product Type: Chemical
| application(s) |
food and beverages |
| assay |
≥98.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| impurities |
≤5.0% water |
| InChI |
1S/C20H20O7/c1-22-12-8-6-11(7-9-12)14-10-13(21)15-16(23-2)18(24-3)20(26-5)19(25-4)17(15)27-14/h6-10H,1-5H3 |
| InChI key |
ULSUXBXHSYSGDT-UHFFFAOYSA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
COc1ccc(cc1)C2=CC(=O)c3c(OC)c(OC)c(OC)c(OC)c3O2 |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: |
Tangeretin is a flavonoid found in the peel of citrus fruits where it most likely provides natural resistance to fungi. Tangeretin has been shown to counteract tumor promoter-induced inhibition of intercellular communication and to inhibit cell proliferation in several cancer lines. |
| Symbol |
 GHS06 |
| Signal word |
Danger |
| Hazard statements |
H300 |
| Precautionary statements |
P264 - P301 + P310 |
| Hazard Codes |
T |
| Risk Statements |
25 |
| Safety Statements |
45 |
| RIDADR |
UN 2811 6.1 / PGIII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (HPLC) |
| UNSPSC |
85151701 |
