Glyceryl tributyrate
SIAL/91010 - puriss., ≥98.5% (GC)
Synonym: 1,2,3-
CAS Number: 60-01-5
Empirical Formula (Hill Notation): C15H26O6
Molecular Weight: 302.36
EC Number: 200-451-5
MDL Number: MFCD00009392
Linear Formula: (CH3CH2CH2COOCH2)2CHOCOCH2CH2CH3
Product Type: Chemical
| assay | ≥98.5% (GC) |
| bp | 129-131 °C/0.03 mmHg (lit.) |
| 287-288 °C (lit.) | |
| density | 1.032 g/mL at 20 °C |
| 1.032 g/mL at 20 °C (lit.) | |
| form | liquid |
| functional group | ester |
| grade | puriss. |
| InChI | 1S/C15H26O6/c1-4-7-13(16) |
| InChI key | UYXTWWCETRIEDR-UHFFFAOYSA |
| Quality Level | 200  |
| refractive index | n |
| n |
|
| SMILES string | CCCC(=O)OCC(COC(=O)CCC)OC |
| Application: | Glyceryl tributyrate can be used as: • A model compound to study transesterification in vegetable oil for the synthesis of biodiesel catalyzed by the metal-loaded MgAl oxides. • A reactant in the synthesis of methyl butanoate by transesterification with methanol using Li-promoted CaO catalysts. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 345.2 °F - closed cup |
| Flash Point(C) | 174 °C - closed cup |
| Purity | ≥98.5% (GC) |
| bp | 129-131 °C/0.03 mmHg (lit.); 287-288 °C (lit.) |
| Density | 1.032 g/mL at 20 °C (lit.); 1.032 g/mL at 20 °C |
| Refractive Index | n |
| UNSPSC | 12352100 |