Synonym: (2R)-3-Carboxy-N,N,N-trimethyl-2-(2-methyl-1-oxopropoxy)-1-propanaminium inner salt; L-Carnitine isobutyryl ester; iC4-Carnitine
CAS Number: 25518-49-4
Empirical Formula (Hill Notation): C11H21NO4
Molecular Weight: 231.29
MDL Number: MFCD01674829
Linear Formula: C11H21NO4
Product Type: Chemical
| application(s) |
clinical testing |
| assay |
≥97.0% (HPLC) |
| format |
neat |
| grade |
analytical standard |
| impurities |
≤10.0% water (calculated from elemental analysis) |
| InChI |
1S/C11H21NO4/c1-8(2)11(15)16-9(6-10(13)14)7-12(3,4)5/h8-9H,6-7H2,1-5H3/t9-/m1/s1 |
| InChI key |
LRCNOZRCYBNMEP-SECBINFHSA-N |
| optical activity |
[α]/D -22.0±2.0°, c = 0.1 in H2O |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
C[N+](C)(C)C[C@H](OC(C(C)C)=O)CC([O-])=O |
| storage temp. |
2-8°C |
| Application: |
Isobutyryl-L-carnitine may be used as an analytical reference standard for the separation and identification of underivatized isobutyryl-L-carnitine in human plasma samples using high-performance liquid chromatography coupled to tandem mass spectrometry (HPLC-MS/MS). It may also be used as an analytical reference standard for the quantification of the analyte in human urine samples using liquid chromatography/electrospray ionization tandem mass spectrometry (LC/ESI-MS/MS). |
| General description: |
Isobutyryl-L-carnitine belongs to the acylcarnitines class of compounds. These compounds are produced from L-carnitine, which plays an important role in fatty acid metabolic pathways. The functions and roles of acyl-L-carnitines in various tissues like brain, heart, and muscle continue to attract much interest. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (HPLC) |
| Storage Temp. |
2-8°C |
| UNSPSC |
41116107 |
