Synonym: 1,7,7-Trimethyl-3-(phenylmethylene)bicyclo[2.2.1]heptan-2-one; 3-BC; 3-Benzylidene-1,7,7-trimethyl-norbornan-2-one; 3-Benzylidene-2-bornanone
CAS Number: 15087-24-8
Empirical Formula (Hill Notation): C17H20O
Molecular Weight: 240.34
EC Number: 239-139-9
MDL Number: MFCD00441748
Linear Formula: C17H20O
Product Type: Chemical
| application(s) |
environmental |
| assay |
≥97.0% (GC) |
| format |
neat |
| grade |
analytical standard |
| InChI |
1S/C17H20O/c1-16(2)14-9-10-17(16,3)15(18)13(14)11-12-7-5-4-6-8-12/h4-8,11,14H,9-10H2,1-3H3/b13-11- |
| InChI key |
OIQXFRANQVWXJF-QBFSEMIESA-N |
| Quality Level |
100  |
| shelf life |
limited shelf life, expiry date on the label |
| SMILES string |
C[C@]1(C/2=O)CC[C@@H](C1(C)C)C2=CC3=CC=CC=C3 |
| technique(s) |
gas chromatography (GC): suitable |
| |
HPLC: suitable |
| Application: |
Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol |
 GHS08 |
| Signal word |
Warning |
| Hazard statements |
H361fd |
| Precautionary statements |
P281 |
| Hazard Codes |
Xn |
| Risk Statements |
63-62 |
| Safety Statements |
36/37 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥97.0% (GC) |
| UNSPSC |
85151701 |
