Genistein
SIAL/92136 - analytical standard
Synonym: 4′,5,7-Trihydroxyisoflavone; 5,7-
CAS Number: 446-72-0
Empirical Formula (Hill Notation): C15H10O5
Molecular Weight: 270.24
EC Number: 207-174-9
MDL Number: MFCD00016952
Linear Formula: C15H10O5
Product Type: Chemical
| application(s) | food and beverages |
| assay | ≥97% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H10O5/c16-9-3-1-8(2 |
| InChI key | TZBJGXHYKVUXJN-UHFFFAOYSA |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | Oc1ccc(cc1)C2=COc3cc(O)cc |
| storage temp. | 2-8°C |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: | Inhibitor of tyrosine protein kinase; competitive inhibitor of ATP in other protein kinase reactions. Antiangiogenic agent, down-regulates the transcription of genes involved in controlling angiogenesis. |
| General description: | Genistein, a naturally occurring soy isoflavone, is a dietary protein tyrosine kinase (PTK) inhibitor. It is found to possess anticarcinogenic properties. |
| Packaging: | 10 mg in glass bottle |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264 - P270 - P301 + P312 - P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97% (HPLC) |
| Storage Temp. | 2-8°C |
| UNSPSC | 85151701 |