Mefenamic acid
SIAL/92574 - analytical standard
Synonym: 2-
CAS Number: 61-68-7
Empirical Formula (Hill Notation): C15H15NO2
Molecular Weight: 241.29
EC Number: 200-513-1
MDL Number: MFCD00051721
Linear Formula: C15H15NO2
Product Type: Chemical
| application(s) | forensics and toxicology pharmaceutical (small molecule) veterinary |
| assay | ≥98.5% (HPLC) |
| format | neat |
| grade | analytical standard |
| impurities | ≤1.0% water |
| InChI | 1S/C15H15NO2/c1-10-6-5-9- |
| InChI key | HYYBABOKPJLUIN-UHFFFAOYSA |
| Quality Level | 100  |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | Cc1cccc(Nc2ccccc2C(O)=O)c |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | An NSAID. Circumvents MRP-mediated multidrug resistance. Specifically and significantly potentiates the cytotoxicity of anthracyclines (doxorubicin, daunorubicin and epirubicin), as well as teniposide, VP-16 and vincristine. |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.5% (HPLC) |
| UNSPSC | 41116107 |