Synonym: 4-(N,N-Dimethylamino)benzhydrazide; 4-(N,N-Dimethylamino)benzoic hydrazide; 4-(N,N-Dimethylamino)benzoylhydrazine; 4-(N,NDimethylamino)benzoic acid hydrazide; p(Nme2)-Ph-CONHNH2; NSC 219987
CAS Number: 19353-92-5
Empirical Formula (Hill Notation): C9H13N3O
Molecular Weight: 179.22
MDL Number: MFCD00014761
Linear Formula: C9H13N3O
Product Type: Chemical
| assay |
≥99.0% (HPLC) |
| form |
powder |
| grade |
for HPLC derivatization |
| InChI |
1S/C9H13N3O/c1-12(2)8-5-3-7(4-6-8)9(13)11-10/h3-6H,10H2,1-2H3,(H,11,13) |
| InChI key |
HITIGLAGJBMISF-UHFFFAOYSA-N |
| quality |
LiChropur™ |
| Quality Level |
100  |
| SMILES string |
O=C(NN)C1=CC=C(N(C)C)C=C1 |
| Legal Information: |
LiChropur is a trademark of Merck KGaA, Darmstadt, Germany |
| Recommended products: |
Discover LiChropur™ reagents ideal for HPLC or LC-MS analysis |
| Symbol |
  GHS07,GHS08 |
| Signal word |
Warning |
| Hazard statements |
H302 - H317 - H351 |
| Precautionary statements |
P280 |
| Hazard Codes |
Xn |
| Risk Statements |
22-40-43 |
| Safety Statements |
36/37 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥99.0% (HPLC) |
| UNSPSC |
41121800 |
