Carbamazepine 10,11-epoxide
SIAL/93203 - analytical standard
Synonym: 1a,10b-Dihydro-6H-dibenzo(b,f)oxireno[d]
CAS Number: 36507-30-9
Empirical Formula (Hill Notation): C15H12N2O2
Molecular Weight: 252.27
MDL Number: MFCD00467137
Linear Formula: C15H12N2O2
Product Type: Chemical
| application(s) | forensics and toxicology pharmaceutical (small molecule) |
| assay | ≥99.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C15H12N2O2/c16-15(18)1 |
| InChI key | ZRWWEEVEIOGMMT-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | NC(=O)N1c2ccccc2C3OC3c4cc |
| storage temp. | −20°C |
| technique(s) | gas chromatography (GC): suitable |
| liquid chromatography (LC): suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Symbol | GHS09 |
| Hazard statements | H411 |
| Precautionary statements | P273 |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (HPLC) |
| Storage Temp. | −20°C |
| UNSPSC | 41116107 |


