Hexyl 2-[4-(diethylamino)-2-hydroxybenzoyl]benzoate
SIAL/93777 - analytical standard
Synonym: DHHB; Diethylamino hydroxybenzoyl hexyl benzoate
CAS Number: 302776-68-7
Empirical Formula (Hill Notation): C24H31NO4
Molecular Weight: 397.51
EC Number: 443-860-6
MDL Number: MFCD11616752
Linear Formula: C24H31NO4
Product Type: Chemical
| application(s) | cleaning products cosmetics environmental food and beverages personal care |
| assay | ≥98.0% (HPLC) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C24H31NO4/c1-4-7-8-11- |
| InChI key | FDATWRLUYRHCJE-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | CCCCCCOC(=O)c1ccccc1C(=O) |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Hexyl 2-[4-(diethylamino)-2-hyd |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| General description: | Hexyl 2-[4-(diethylamino)-2-hyd |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Hazard statements | H413 |
| Risk Statements | 53 |
| Safety Statements | 61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (HPLC) |
| UNSPSC | 41116107 |

