Citric acid monohydrate
SIAL/C0706 - BioXtra, ≥99.5%
CAS Number: 5949-29-1
Empirical Formula (Hill Notation): C6H8O7 · H2O
Molecular Weight: 210.14
EC Number: 201-069-1
MDL Number: MFCD00149972
Linear Formula: HOC(COOH)(CH2COOH)2 · H2O
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: C0706-500G
This image depicts SKU: C0706-500G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: C0706-1KG
This image depicts SKU: C0706-1KG
| anion traces | chloride (Cl-): ≤0.001% |
| sulfate (SO42-): ≤0.002% | |
| ash | ≤0.02% |
| assay | ≥99.5% |
| cation traces | Al: ≤0.0005% |
| Ca: ≤0.0005% | |
| Cu: ≤0.0005% | |
| Fe: ≤0.0005% | |
| K: ≤0.005% | |
| Mg: ≤0.0005% | |
| Na: ≤0.005% | |
| NH4+: ≤0.05% | |
| Pb: ≤0.001% | |
| Zn: ≤0.0005% | |
| form | powder |
| impurities | ≤0.002% Phosphorus (P) |
| ≤0.005% Insoluble matter | |
| InChI | 1S/C6H8O7.H2O/c7-3(8)1-6( |
| InChI key | YASYEJJMZJALEJ-UHFFFAOYSA |
| pH | 1.85 (25 °C, 50 g/L) |
| pKa | (1) 3.13, (2) 4.76, (3) 6.4 |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | OC(CC(O)(C(O)=O)CC(O)=O)= |
| solubility | H2O: 1 M, clear, colorless |
| Application: | Citric acid monohydrate has been used: • as carbon source of carbon nanodot synthesis • in the preparation of citric acid monohydrate solution/buffer of pH-6.0 for tissue sample preparation • to treat various samples in citric acid solubilisation technique |
| Biochem/physiol Actions: | Citric acid plays a major role in textile, food, pharmaceutical, metal and chemical industries. Melting citric acid monohydrate can give rise to itaconic anhydride. The crystals of citric acid monohydrate has the ability to preserve water up to 56 degree celsius. |
| General description: | Citric acid is one of the fruits acids. It is present in various citrus fruits and vegetables. |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 500 g in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 345.0 °F |
| Flash Point(C) | 173.9 °C |
| Purity | ≥99.5% |
| UNSPSC | 12161700 |