Captopril
SIAL/C8856 - meets USP testing specifications
Synonym: N-
CAS Number: 62571-86-2
Empirical Formula (Hill Notation): C9H15NO3S
Molecular Weight: 217.29
EC Number: 263-607-1
MDL Number: MFCD00168073
Linear Formula: C9H15NO3S
Product Type: Chemical
| agency | meets USP testing specifications |
| USP/NF | |
| assay | 97.5-102.0% dry basis |
| biological source | synthetic (organic) |
| form | crystalline |
| InChI | 1S/C9H15NO3S/c1-6(5-14)8( |
| InChI key | FAKRSMQSSFJEIM-RQJHMYQMSA |
| mp | 104-108 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | C[C@H](CS)C(=O)N1CCC[C@H] |
| storage temp. | room temp |
| Biochem/physiol Actions: | Angiotensin converting enzyme inhibitor. Inhibits the formation of angiotensin II, a bioactive peptide that stimulates angiogenesis and increases microvessel density. |
| Packaging: | 1, 5, 25 g in glass bottle |
| Symbol | GHS08 |
| Signal word | Danger |
| Hazard statements | H341 - H360F |
| Precautionary statements | P201 - P308 + P313 |
| Hazard Codes | Xn |
| Risk Statements | 63-43 |
| Safety Statements | 36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97.5-102.0% dry basis |
| mp | 104-108 °C (lit.) |
| Storage Temp. | room temp |
| UNSPSC | 41116107 |


