Caffeine
SIAL/C8960 - BioXtra
Synonym: 1,3,7-
CAS Number: 58-08-2
Empirical Formula (Hill Notation): C8H10N4O2
Molecular Weight: 194.19
EC Number: 200-362-1
MDL Number: MFCD00005758
Linear Formula: C8H10N4O2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: C8960-250G
This image depicts SKU: C8960-250G
| anion traces | chloride (Cl-): ≤0.05% |
| sulfate (SO42-): ≤0.05% | |
| cation traces | Al: ≤0.0005% |
| Ca: ≤0.001% | |
| Cu: ≤0.0005% | |
| Fe: ≤0.0005% | |
| K: ≤0.005% | |
| Mg: ≤0.001% | |
| Na: ≤0.005% | |
| NH4+: ≤0.05% | |
| Pb: ≤0.001% | |
| Zn: ≤0.0005% | |
| form | powder |
| ign. residue | ≤0.1% |
| impurities | ≤0.0005% Phosphorus (P) |
| ≤0.1% Insoluble matter | |
| InChI | 1S/C8H10N4O2/c1-10-4-9-6- |
| InChI key | RYYVLZVUVIJVGH-UHFFFAOYSA |
| mp | 234-236.5 °C (lit.) |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | CN1C(=O)N(C)c2ncn(C)c2C1= |
| solubility | chloroform: 0.5 M, clear, colorless |
| Packaging: | 1 kg in poly drum |
| Packaging: | 250 g in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301 + P312 + P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 234-236.5 °C (lit.) |
| UNSPSC | 12352210 |