1-Methoxy-5-methylphenazinium methyl sulfate
SIAL/M8640 - ≥95%
Synonym: 1-Methoxyphenazine methosulfate
CAS Number: 65162-13-2
Empirical Formula (Hill Notation): C15H16N2O5S
Molecular Weight: 336.36
EC Number: 265-579-6
MDL Number: MFCD00040648
Linear Formula: C15H16N2O5S
Product Type: Chemical
| application(s) | diagnostic assay manufacturing hematology histology |
| assay | ≥95% |
| color | red to brown |
| composition | Nitrogen: ≥ 7.9% |
| form | powder |
| InChI | 1S/C14H13N2O.CH4O4S/c1-16 |
| InChI key | MASUWVVNWALEEM-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | COS([O-])(=O)=O.COc1cccc2 |
| solubility | H2O: 1 mg/mL, clear, red |
| storage temp. | room temp |
| technique(s) | titration: suitable |
| Application: | 1-Methoxy-5-methylphenazi |
| General description: | 1-Methoxy-5-methylphenazi |
| Packaging: | 100, 500 mg in glass bottle |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302 - H315 - H319 - H341 - H351 - H361d - H373 |
| Precautionary statements | P202 - P260 - P301 + P312 - P302 + P352 - P305 + P351 + P338 - P308 + P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38-40 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Purity | ≥95% |
| Storage Temp. | room temp |
| UNSPSC | 12171500 |



