TWEEN® 80
SIAL/P8074 - BioXtra, viscous liquid
Synonym: TWEEN® 80; POE (20) sorbitan monooleate; Polyethylene glycol sorbitan monooleate; Polyoxyethylenesorbitan monooleate; Polysorbate 80
CAS Number: 9005-65-6
MDL Number: MFCD00082107
Product Type: Chemical
| aggregation number | 60 |
| anion traces | chloride (Cl-): <0.05% |
| sulfate (SO42-): <0.05% | |
| cation traces | Al: <0.0005% |
| Ca: <0.001% | |
| Cu: <0.0005% | |
| Fe: <0.0005% | |
| K: <0.005% | |
| Mg: <0.0005% | |
| Na: <0.05% | |
| NH4+: <0.05% | |
| Pb: <0.001% | |
| Zn: <0.0005% | |
| CMC | 0.012 mM (20-25°C) |
| composition | Oleic acid, ~70% (balance primarily linoleic, palmitic, and stearic acids) |
| density | 1.06 g/mL at 25 °C |
| description | non-ionic |
| form | viscous liquid |
| HLB | 15 |
| ign. residue | <0.1% |
| impurities | ≤0.025% Phosphorus (P) |
| InChI | 1S/C32H60O10/c1-2-3-4-5-6 |
| InChI key | RGPBUVUVZKQNHD-MDZDMXLPSA |
| mol wt | average mol wt 1310 |
| micellar avg mol wt 79,000 | |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | CCCCCCCC/C=C/CCCCCCCC(=O) |
| technique(s) | cell culture | mammalian: suitable |
| DNA extraction: suitable | |
| protein purification: suitable | |
| RNA extraction: suitable | |
| transition temp | cloud point 65 °C |
| Application: | ["TWEEN"] 80 has been used: • to dissolve rapamycin (RAPA) for immunosuppressive treatment to perform in vivo studies in mice • to dissolve remodelin and remodelin Fluor to assess remodelin toxicity in vivo and small molecule dosing • to prepare assay medium for the microbiological assay for total folate |
| General description: | ["TWEEN"] 80 is a polyethylene sorbitol ester, broadly used in biochemical applications like solubilizing proteins, isolating nuclei from cells in culture, and growing tubercle bacilli. It is also useful in emulsifying and dispersing substances in medicinal and food products. TWEEN 80 acts as an active drying agent in ice cream. |
| Legal Information: | TWEEN is a registered trademark of Croda International PLC |
| Packaging: | 100, 500 mL in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 1.06 g/mL at 25 °C |
| UNSPSC | 12161900 |