Tolbutamide
SIAL/T0891 - analytical standard
Synonym: 1-
CAS Number: 64-77-7
Empirical Formula (Hill Notation): C12H18N2O3S
Molecular Weight: 270.35
EC Number: 200-594-3
MDL Number: MFCD00027169
Linear Formula: C12H18N2O3S
Product Type: Chemical
| application(s) | forensics and toxicology pharmaceutical (small molecule) |
| assay | 97.0-103.0% |
| biological source | synthetic (organic) |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C12H18N2O3S/c1-3-4-9-1 |
| InChI key | JLRGJRBPOGGCBT-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | CCCCNC(=O)NS(=O)(=O)c1ccc |
| solubility | ethanol: 50 mg/mL, clear, colorless |
| technique(s) | gas chromatography (GC): suitable |
| HPLC: suitable |
| Application: | Refer to the product′s Certificate of Analysis for more information on a suitable instrument technique. Contact Technical Service for further support. |
| Biochem/physiol Actions: | Anti-diabetic agent. Metabolized by CYP2C9 (tolbutamide hydroxylase). |
| Packaging: | 25, 100, 500 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97.0-103.0% |
| UNSPSC | 41116107 |

