Linoleic acid
SIAL/W338020 - ≥95%, FG
Synonym: cis-9,cis-12-Octadecadienoic acid
CAS Number: 60-33-3
Empirical Formula (Hill Notation): C18H32O2
Molecular Weight: 280.45
EC Number: 200-470-9
MDL Number: MFCD00064241
Linear Formula: CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2H
Product Type: Chemical
| agency | follows IFRA guidelines |
| application(s) | flavors and fragrances |
| assay | ≥95% |
| biological source | peanut oil |
| synthetic | |
| bp | 229-230 °C/16 mmHg (lit.) |
| density | 0.902 g/mL at 25 °C (lit.) |
| documentation | see Safety & Documentation for available documents |
| food allergen | peanuts |
| fragrance allergen | no known allergens |
| grade | FG |
| Fragrance grade | |
| Halal | |
| InChI | 1S/C18H32O2/c1-2-3-4-5-6- |
| InChI key | OYHQOLUKZRVURQ-HZJYTTRNSA |
| mp | −5 °C (lit.) |
| organoleptic | faint; fatty |
| Quality Level | 400  |
| refractive index | n |
| reg. compliance | EU Regulation 1223/2009 |
| EU Regulation 1334/2008 & 178/2002 | |
| FDA 21 CFR 184.1065 | |
| SMILES string | OC(CCCCCCC/C=CC/C=CCCCC |
| storage temp. | 2-8°C |
| Biochem/physiol Actions: | Linoleic acid increases cell proliferation and gene expression of PPARα and its target genes such as acyl-CoA oxidase in primary duck hepatocytes . |
| Packaging: | 1 kg in poly bottle |
| Packaging: | 100 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥95% |
| bp | 229-230 °C/16 mmHg (lit.) |
| mp | −5 °C (lit.) |
| Density | 0.902 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| FEMA Number | 3380 |
| UNSPSC | 12164502 |