Citric acid
SIGALD/27109 - meets analytical specification of Ph. Eur., BP, USP, E330, anhydrous, 99.5-100.5% (based on anhydrous substance)
CAS Number: 77-92-9
Empirical Formula (Hill Notation): C6H8O7
Molecular Weight: 192.12
EC Number: 201-069-1
MDL Number: MFCD00011669
Linear Formula: HOC(COOH)(CH2COOH)2
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 27109-1KG-R
This image depicts SKU: 27109-1KG-R
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 27109-6X1KG-R
This image depicts SKU: 27109-6X1KG-R
| anion traces | chloride (Cl-): ≤50 ppm |
| oxalate (as oxalic acid): ≤100 ppm | |
| sulfate (SO42-): ≤100 ppm | |
| assay | 99.5-100.5% (based on anhydrous substance) |
| cation traces | As: ≤1 ppm |
| Ca: ≤200 ppm | |
| Cu: ≤10 ppm | |
| Fe: ≤10 ppm | |
| Hg: ≤1 ppm | |
| Pb: ≤0.5 ppm | |
| Zn: ≤10 ppm | |
| expl. lim. | 8 %, 65 °F |
| form | grit |
| ign. residue | ≤0.05% (as SO4) |
| impurities | residual solvents, complies |
| ≤0.0005% heavy metals (as Pb) | |
| ≤0.5% water (Karl Fischer) | |
| InChI | 1S/C6H8O7/c7-3(8)1-6(13,5 |
| InChI key | KRKNYBCHXYNGOX-UHFFFAOYSA |
| mp | 153-159 °C (lit.) |
| pKa | (1) 3.13, (2) 4.76, (3) 6.4 |
| quality | anhydrous |
| meets analytical specification of Ph. Eur., BP, USP, E330 | |
| Quality Level | 200  |
| SMILES string | OC(=O)CC(O)(CC(O)=O)C(O)= |
| solubility | water: 383 g/L at 25 °C |
| suitability | complies for appearance of solution |
| complies for reaction against H2SO4 |
| Application: | Citric acid was used as a test reagent for studying whether the novel pyridazinylpiperazine analog TPRV-1 inhibitor can reduce cough reflex induced by citric acid and capsaicin in guinea pig. |
| Biochem/physiol Actions: | Citric acid in dietary form can augments absorption of aluminium in antacids. It also facilitates the phytoremediation of heavy metal contaminated soil and can transform cadmium into more transportable forms. |
| Packaging: | 1, 6×1 kg in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264 - P280 - P305 + P351 + P338 - P337 + P313 |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99.5-100.5% (based on anhydrous substance) |
| mp | 153-159 °C (lit.) |
| UNSPSC | 12352106 |