Sodium phosphate monobasic monohydrate
SIGALD/71504 - puriss. p.a., ACS reagent, ≥99.0% (T)
Synonym: Monosodium phosphate; Sodium dihydrogen phosphate monohydrate
CAS Number: 10049-21-5
Empirical Formula (Hill Notation): H2NaO4P · H2O
Molecular Weight: 137.99
EC Number: 231-449-2
MDL Number: MFCD00149208
Linear Formula: NaH2PO4 · H2O
Product Type: Chemical
| anion traces | chloride (Cl-): ≤5 mg/kg |
| sulfate (SO42-): ≤30 mg/kg | |
| assay | ≥99.0% (T) |
| cation traces | As: ≤0.5 mg/kg |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| heavy metals: ≤0.001% (by ICP-OES) | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | crystals |
| grade | ACS reagent |
| puriss. p.a. | |
| impurities | ≤0.001% total nitrogen (N) |
| ≤0.01% insoluble matter | |
| InChI | 1S/Na.H3O4P.H2O/c;1-5(2,3 |
| InChI key | BBMHARZCALWXSL-UHFFFAOYSA |
| pH | 4.1-4.5 (25 °C, 50 mg/mL in H2O) |
| Quality Level | 200  |
| SMILES string | [Na+].[H]O[H].OP(O)([O-]) |
| Application: | Sodium phosphate monobasic monohydrate may be used in the following studies: • As a mobile phase in HPLC studies. • For the dissolution of BSA (Bovine serum albumin). • Preparation of buffer solutions. |
| General description: | Sodium phosphate monobasic monohydrate is a sodium salt. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T) |
| UNSPSC | 12352300 |