N-Acetyl-D-penicillamine
SIGMA/01423 - for HPLC derivatization, ≥99.0% (T)
Synonym: NAP; NAPA; N-Acetyl-3-mercapto-D-valine
CAS Number: 15537-71-0
Empirical Formula (Hill Notation): C7H13NO3S
Molecular Weight: 191.25
EC Number: 239-585-4
MDL Number: MFCD00078887
Linear Formula: C7H13NO3S
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | ≥99.0% (T) |
| color | white |
| form | powder or crystals |
| grade | for HPLC derivatization |
| InChI | 1S/C7H13NO3S/c1-4(9)8-5(6 |
| InChI key | MNNBCKASUFBXCO-YFKPBYRVSA |
| mp | 185-190 °C (dec.) |
| optical activity | [α]20/D +10±2°, c = 1% in ethanol |
| Quality Level | 100  |
| SMILES string | CC(=O)N[C@@H](C(O)=O)C(C) |
| technique(s) | HPLC: suitable (derivatization) |
| Application: | Chiral reagent for the precolumn derivatization of amino acids or amino alcohols; the diastereoisomers formed can be efficiently resolved by HPLC on conventional reversed-phase columns |
| Biochem/physiol Actions: | N-Acetyl-D-penicillamine (NAP or NAPA), a thiol compound, is often used as a control molecule in studies involving nitric oxide donor molecules such as S-nitroso-N-acetyl-dl-pen |
| Recommended products: | Discover LiChropur reagents ideal for HPLC or LC-MS analysis |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (T) |
| mp | 185-190 °C (dec.) |
| UNSPSC | 12352116 |