L-Arginine
SIGMA/11009 - BioUltra, ≥99.5% (NT)
Synonym: (S)
CAS Number: 74-79-3
Empirical Formula (Hill Notation): C6H14N4O2
Molecular Weight: 174.20
EC Number: 200-811-1
MDL Number: MFCD00002635
Linear Formula: H2NC(=NH)NH(CH2)3CH(NH2)CO2H
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 11009-100G-F
This image depicts SKU: 11009-100G-F
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 11009-500G-F
This image depicts SKU: 11009-500G-F
| λ | 0.5 M in H2O |
| anion traces | chloride (Cl-): ≤100 mg/kg |
| sulfate (SO42-): ≤100 mg/kg | |
| application(s) | peptide synthesis |
| assay | ≥99.5% (NT) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | white |
| form | powder or crystals |
| ign. residue | ≤0.05% (as SO4) |
| impurities | insoluble matter, passes filter test |
| ≤0.3% foreign amino acids | |
| InChI | 1S/C6H14N4O2/c7-4(5(11)12 |
| InChI key | ODKSFYDXXFIFQN-BYPYZUCNSA |
| loss | ≤0.1% loss on drying, 20 °C (HV) |
| mp | 222 °C (dec.) (lit.) |
| optical activity | [α]20/D +27.0±0.5°, c = 5% in 5 M HCl |
| pH | 10.5-12.0 (25 °C, 0.5 M in H2O) |
| product line | BioUltra |
| Quality Level | 100  |
| SMILES string | N[C@@H](CCCNC(N)=N)C(O)=O |
| solubility | H2O: 0.5 M at 20 °C, clear, colorless |
| UV absorption | λ: 260 nm Amax: ≤0.2 |
| λ: 280 nm Amax: ≤0.1 |
| Biochem/physiol Actions: | Substrate of nitric oxide synthase, which is converted to citrulline and nitric oxide (NO). Induces insulin release by a nitric oxide-dependent mechanism. |
| Other Notes: | Exhibits stabilizing effects on plant protoplasts; pH drift correction in IEF of proteins; Growth requirement of various microorganisms. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% (NT) |
| mp | 222 °C (dec.) (lit.) |
| UNSPSC | 12352200 |