L-Arginine monohydrochloride
SIGMA/11039 - BioUltra, ≥99.5% (AT)
Synonym: (S)
CAS Number: 1119-34-2
Empirical Formula (Hill Notation): C6H14N4O2 · HCl
Molecular Weight: 210.66
EC Number: 214-275-1
MDL Number: MFCD00064550
Linear Formula: C6H14N4O2 · HCl
Product Type: Chemical
| λ | 1 M in H2O |
| anion traces | sulfate (SO42-): ≤50 mg/kg |
| assay | ≥99.5% (AT) |
| cation traces | Al: ≤5 mg/kg |
| As: ≤0.1 mg/kg | |
| Ba: ≤5 mg/kg | |
| Bi: ≤5 mg/kg | |
| Ca: ≤10 mg/kg | |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Li: ≤5 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Mo: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Sr: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| color | colorless or white |
| density | 1.42 g/cm3 at 20 °C |
| form | powder or crystals |
| ign. residue | ≤0.05% |
| impurities | insoluble matter, passes filter test |
| ≤0.3% foreign amino acids | |
| InChI | 1S/C6H14N4O2.ClH/c7-4(5(1 |
| InChI key | KWTQSFXGGICVPE-WCCKRBBISA |
| loss | ≤0.05% loss on drying, 20 °C (HV) |
| mp | 220-230 °C |
| optical activity | [α]20/D +22.0±0.5°, c = 5% in 5 M HCl |
| pH | 5.5-7.0 (25 °C, 1 M in H2O) |
| product line | BioUltra |
| Quality Level | 200  |
| SMILES string | Cl[H].N[C@@H](CCCNC(N)=N) |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| technique(s) | ligand binding assay: suitable |
| UV absorption | λ: 260 nm Amax: ≤0.2 |
| λ: 280 nm Amax: ≤0.1 |
| Application: | L-Arginine monohydrochloride has been used to study the reversal of the inhibitory effect of L-NG0-nitroarginine on non-cholinergic relaxations. It has also been used as a dietary supplement to study its effect on endothelium-dependent vasodilation. |
| Biochem/physiol Actions: | L-Arginine is considered as a semi essential amino acid. In most mammals including humans, L-Arginine synthesis occurs through intestinal-renal axis, from glutamine, glutamate and proline. Abnormal levels of L-Arginine is associated with the development of kidney and cardiovascular disease. L-arginine is found to decrease fat mass and visceral adiposity. |
| Biochem/physiol Actions: | Substrate of nitric oxide synthase, which is converted to citrulline and nitric oxide (NO). Induces insulin release by a nitric oxide-dependent mechanism. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.5% (AT) |
| mp | 220-230 °C |
| Density | 1.42 g/cm3 at 20 °C |
| UNSPSC | 12352209 |