1,4-Bis(acryloyl)piperazine
SIGMA/14470 - BioXtra, suitable for electrophoresis, ≥99.0% (TLC)
Synonym: 1,4-
CAS Number: 6342-17-2
Empirical Formula (Hill Notation): C10H14N2O2
Molecular Weight: 194.23
MDL Number: MFCD00077661
Linear Formula: C10H14N2O2
Product Type: Chemical
| anion traces | chloride (Cl-): ≤200 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% (TLC) |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Co: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| form | solid |
| impurities | ≤0.05% free acrylic acid |
| InChI | 1S/C10H14N2O2/c1-3-9(13)1 |
| InChI key | YERHJBPPDGHCRJ-UHFFFAOYSA |
| mp | 91.5-93.5 °C (lit.) |
| product line | BioXtra |
| Quality Level | 100  |
| SMILES string | C=CC(=O)N1CCN(CC1)C(=O)C= |
| storage temp. | 2-8°C |
| suitability | suitable for electrophoresis |
| technique(s) | electrophoresis: suitable |
| Other Notes: | Used as a vinylating agent for graft-copolymerization of different enzymes to cellulose, dextran, or starch; New crosslinking agent for polyacrylamide gels with improved protein separation and detection by silver staining; Increased resolution in 2D-protein electrophoresis. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P261 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (TLC) |
| mp | 91.5-93.5 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352200 |