3-(Benzyldimethylammonio)propanesulfonate
SIGMA/17236 - BioXtra, ≥99.0% (HPCE)
Synonym: 3-
CAS Number: 81239-45-4
Empirical Formula (Hill Notation): C12H19NO3S
Molecular Weight: 257.35
MDL Number: MFCD00225018
Linear Formula: C6H5CH2N+(CH3)2CH2CH2CH2SO3−
Product Type: Chemical
| anion traces | chloride (Cl-): ≤50 mg/kg |
| sulfate (SO42-): ≤50 mg/kg | |
| assay | ≥99.0% (HPCE) |
| cation traces | Ca: ≤10 mg/kg |
| Cd: ≤5 mg/kg | |
| Cr: ≤5 mg/kg | |
| Cu: ≤5 mg/kg | |
| Fe: ≤5 mg/kg | |
| K: ≤50 mg/kg | |
| Mg: ≤5 mg/kg | |
| Mn: ≤5 mg/kg | |
| Na: ≤50 mg/kg | |
| Ni: ≤5 mg/kg | |
| Pb: ≤5 mg/kg | |
| Zn: ≤5 mg/kg | |
| description | zwitterionic |
| form | powder |
| InChI | 1S/C12H19NO3S/c1-13(2,9-6 |
| InChI key | MEJASPJNLSQOAG-UHFFFAOYSA |
| product line | BioXtra |
| Quality Level | 200  |
| SMILES string | C[N+](C)(CCCS([O-])(=O)=O |
| solubility | H2O: 10 mg/mL, clear, colorless |
| Other Notes: | Ampholytic detergent used to enhance solubility of proteins in electrophoresis. |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (HPCE) |
| UNSPSC | 12161900 |