5(6)-Carboxy-X-rhodamine
SIGMA/21965 - BioReagent, suitable for fluorescence
CAS Number: 198978-94-8
Empirical Formula (Hill Notation): C33H30N2O5
Molecular Weight: 534.60
MDL Number: MFCD01862979
Linear Formula: C33H30N2O5
Product Type: Chemical
| fluorescence | λex 570 nm; λem ~595 nm in 0.1 M Tris pH 8.0 |
| InChI | 1S/2C33H30N2O5/c36-31(37) |
| InChI key | KLNOCCPJAOCRHF-UHFFFAOYSA |
| mp | ≥250 °C (lit.) |
| product line | BioReagent |
| Quality Level | 100 ![]() |
| SMILES string | OC(=O)c1ccc2c(c1)C(=O)OC2 |
| suitability | suitable for fluorescence |
| Analysis Note: | partially soluble in methanol, 0.1 M Tris pH 8.0 |
| Application: | 5(6)-Carboxy-X-rhodamine may be used as a fluorescent dye in nucleic acid analytical research applications. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | ≥250 °C (lit.) |
| UNSPSC | 12352116 |


