Citric acid
SIGMA/27487 - BioUltra, anhydrous, ≥99.5% (T)
CAS Number: 77-92-9
Empirical Formula (Hill Notation): C6H8O7
Molecular Weight: 192.12
EC Number: 201-069-1
MDL Number: MFCD00011669
Linear Formula: HOC(COOH)(CH2COOH)2
Product Type: Chemical
λmax | 260 nm (Amax: ≤0.20) |
280 nm (Amax: ≤0.10) | |
λ | 1 M in H2O |
anion traces | chloride (Cl-): ≤5 mg/kg |
oxalate (C2O42-): ≤0.05% | |
phosphate (PO43-): ≤5 mg/kg | |
sulfate (SO42-): ≤20 mg/kg | |
tartrate (C4H4O62-): ≤0.20% | |
assay | ≥99.5% (T) |
cation traces | Al: ≤5 mg/kg |
As: ≤0.1 mg/kg | |
Ba: ≤5 mg/kg | |
Bi: ≤5 mg/kg | |
Ca: ≤10 mg/kg | |
Cd: ≤5 mg/kg | |
Co: ≤5 mg/kg | |
Cr: ≤5 mg/kg | |
Cu: ≤5 mg/kg | |
Fe: ≤5 mg/kg | |
K: ≤50 mg/kg | |
Li: ≤5 mg/kg | |
Mg: ≤5 mg/kg | |
Mn: ≤5 mg/kg | |
Mo: ≤5 mg/kg | |
Na: ≤50 mg/kg | |
Ni: ≤5 mg/kg | |
Pb: ≤5 mg/kg | |
Sr: ≤5 mg/kg | |
Zn: ≤5 mg/kg | |
expl. lim. | 8 %, 65 °F |
form | powder or crystals |
ign. residue | ≤0.05% (as SO4) |
impurities | insoluble matter, passes filter test |
InChI | 1S/C6H8O7/c7-3(8)1-6(13,5 |
InChI key | KRKNYBCHXYNGOX-UHFFFAOYSA |
loss | ≤0.5% loss on drying, 110 °C |
mp | 153-159 °C (lit.) |
pH | 1.0-2.0 (25 °C, 1 M in H2O) |
pKa | (1) 3.13, (2) 4.76, (3) 6.4 |
product line | BioUltra |
Quality Level | 200 ![]() |
SMILES string | OC(=O)CC(O)(CC(O)=O)C(O)= |
solubility | H2O: 1 M at 20 °C, clear, colorless |
technique(s) | cell culture | hybridoma: suitable |
UV absorption | λ: 260 nm Amax: 0.20 |
λ: 280 nm Amax: 0.10 |
Application: |
|
General description: | Citric acid is a buffer component for triple-column amino acid analysis. It is an optimal buffer for dissociation of radioiodinated antibodies from viable murine tumor cells. |
Symbol | ![]() |
Signal word | Warning |
Hazard statements | H319 |
Precautionary statements | P264 - P280 - P305 + P351 + P338 - P337 + P313 |
Hazard Codes | Xi |
Risk Statements | 36 |
Safety Statements | 26 |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 1 |
Flash Point(F) | Not applicable |
Flash Point(C) | Not applicable |
Purity | ≥99.5% (T) |
mp | 153-159 °C (lit.) |
UNSPSC | 12161700 |