3-Cyanoumbelliferone
SIGMA/28605 - BioReagent, suitable for fluorescence, ≥98.0% (TLC)
Synonym: 3-
CAS Number: 19088-73-4
Empirical Formula (Hill Notation): C10H5NO3
Molecular Weight: 187.15
MDL Number: MFCD00037480
Linear Formula: C10H5NO3
Product Type: Chemical
| assay | ≥98.0% (TLC) |
| fluorescence | λex 408 nm; λem 450 nm in methanol |
| form | powder |
| InChI | 1S/C10H5NO3/c11-5-7-3-6-1 |
| InChI key | IJQYTHQDUDCJEQ-UHFFFAOYSA |
| mp | ≥250 °C (lit.) |
| product line | BioReagent |
| Quality Level | 100  |
| SMILES string | Oc1ccc2C=C(C#N)C(=O)Oc2c1 |
| solubility | alcohols: soluble |
| DMF: soluble | |
| suitability | suitable for fluorescence |
| Application: | 3-Cyano-7-hydroxycoumarin is closely related to 3-cyano-7-ethoxycoumarin which is used as a fluorometric substrate and inhibitor for cytochrome P-450 enzymes and cytochrome P-450-dependent mixed function oxidases. 3-Cyano-7-hydroxycoumarin may be useful to study the kinetics and substrate specificity of cytochrome P-450s. |
| Packaging: | Bottomless glass bottle. Contents are inside inserted fused cone. |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 - H315 - H319 - H335 |
| Precautionary statements | P261 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥98.0% (TLC) |
| mp | ≥250 °C (lit.) |
| UNSPSC | 12352108 |