Dextran from Leuconostoc mesenteroides
SIGMA/31425 - analytical standard, suitable for gel permeation chromatography (GPC), Mw 670,000
CAS Number: 9004-54-0
EC Number: 232-677-5
MDL Number: MFCD00130935
Linear Formula: (C6H10O5)n
Product Type: Chemical
| analyte chemical class(es) | oligosaccharides |
| application(s) | food and beverages |
| format | neat |
| grade | analytical standard |
| InChI | 1S/C18H32O16/c19-1-5(21)9 |
| InChI key | FZWBNHMXJMCXLU-UHFFFAOYSA |
| Mw/Mn | ~2.03 |
| mol wt | Mn ~330,000 |
| Mp ~400,000 | |
| Mw ~670,000 | |
| Quality Level | 100 ![]() |
| SMILES string | O1C(C(C(C(C1CO)O)O)O)OCC2 |
| technique(s) | gel permeation chromatography (GPC): suitable |
| Application: | Use of dextrans as long and hydrophilic spacer arms improves the performance of immobilized proteins acting on macromolecules. |
| General description: | Dextrans are polysaccharides with molecular weights ≥1,000 Dalton, with a linear backbone of α-linked Dextran from Leuconostoc mesenteroides (Mw: 670,000) may be used as an analytical standard to calibrate the column for gel permeation chromatography (GPC). |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352201 |

