Giemsa Stain, Modified Solution
SIGMA/32884 - according to Giemsa
Synonym: Azure eosin methylene blue; Giemsa solution
CAS Number: 51811-82-6
MDL Number: MFCD00081642
Product Type: Chemical
| application(s) | diagnostic assay manufacturing hematology histology |
| color | dark blue |
| density | 1.036 g/cm3 at 20 °C |
| form | liquid |
| InChI | 1S/C14H13N3S.ClH/c1-17(2) |
| InChI key | NALREUIWICQLPS-UHFFFAOYSA |
| pH | 6.9 |
| quality | according to Giemsa |
| Quality Level | 200  |
| SMILES string | [Cl-].CN(C)c1ccc2N=C3C=CC |
| storage temp. | room temp |
| suitability | passes test for UV spectrum |
| technique(s) | UV/Vis spectroscopy: suitable |
| Application: | Modified Giemsa stain may be used for the identification of each human chromosome by differentials staining. |
| General description: | Modified Giemsa stain means when the pH of the Giemsa stain is changed from the usual 6.8 to 9.0. |
| Other Notes: | Giemsa stain, modified, 0.4%, w/v, in buffered methanol solution, pH 6.8. Also contains stabilizers. |
| Principle: | When blood films are stained using Giemsa Stain, the nucleus and cytoplasm of white blood cells take on characteristic blue or pink coloration. The use of purified eosin and thiazine dyes minimizes lot-to-lot variation. |
| Symbol |    GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225 - H301 + H311 + H331 - H370 |
| Precautionary statements | P210 - P233 - P280 - P301 + P310 - P303 + P361 + P353 - P304 + P340 + P311 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | WGK 2 |
| Flash Point(F) | 51.8 °F - closed cup |
| Flash Point(C) | 11 °C - closed cup |
| Density | 1.036 g/cm3 at 20 °C |
| Storage Temp. | room temp |
| UNSPSC | 12171500 |