Synonym: 2,7-Diamino-10-ethyl-9-phenyl-9,10-dihydrophenanthridine; 3,8-Diamino-5,6-dihydro-5-ethyl-6-phenylphenanthridine; Hydroethidine
CAS Number: 104821-25-2
Empirical Formula (Hill Notation): C21H21N3
Molecular Weight: 315.41
MDL Number: MFCD00077335
Linear Formula: C21H21N3
Product Type: Chemical
| assay |
≥95% (HPCE) |
| fluorescence |
λex 358 nm; λem 461 nm |
| |
λex 392 nm; λem 410 nm in methanol |
| form |
solid |
| InChI |
1S/C21H21N3/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14/h3-13,21H,2,22-23H2,1H3 |
| InChI key |
XYJODUBPWNZLML-UHFFFAOYSA-N |
| product line |
BioReagent |
| Quality Level |
100  |
| SMILES string |
CCN1C(c2ccccc2)c3cc(N)ccc3-c4ccc(N)cc14 |
| solubility |
acetonitrile: soluble |
| |
methanol: soluble |
| storage temp. |
−20°C |
| suitability |
suitable for fluorescence |
| Application: |
Dihydroethidium (dHEt), a fluorescene probe, is used to detect the presence of reactive oxygen species (ROS) such as superoxides. |
| Application: |
Redox indicator. Blue fluorescence until oxidized to ethidium. |
| Other Notes: |
B-ring reduced analog of ethidium |
| Packaging: |
Bottomless glass bottle. Contents are inside inserted fused cone. |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥95% (HPCE) |
| Storage Temp. |
−20°C |
| UNSPSC |
12161505 |